C22H35NOSi — CID 100937500
[(2R,3E,9aS)-3-benzylidene-1,2,4,6,7,8,9,9a-octahydroquinolizin-2-yl]oxy-triethylsilane (PubChem CID 100937500) has the molecular formula C22H35NOSi and a molecular weight of 357.61 g/mol. Its IUPAC name is [(2R,3E,9aS)-3-benzylidene-1,2,4,6,7,8,9,9a-octahydroquinolizin-2-yl]oxy-triethylsilane.
| Compound Name | [(2R,3E,9aS)-3-benzylidene-1,2,4,6,7,8,9,9a-octahydroquinolizin-2-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 100937500 |
| Molecular Formula | C22H35NOSi |
| Molecular Weight | 357.61 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | [(2R,3E,9aS)-3-benzylidene-1,2,4,6,7,8,9,9a-octahydroquinolizin-2-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@@H]1C[C@@H]2CCCCN2C/C1=C\c1ccccc1 |
| InChI | InChI=1S/C22H35NOSi/c1-4-25(5-2,6-3)24-22-17-21-14-10-11-15-23(21)18-20(22)16-19-12-8-7-9-13-19/h7-9,12-13,16,21-22H,4-6,10-11,14-15,17-18H2,1-3H3/b20-16+/t21-,22+/m0/s1 |
| InChIKey | QJFIDYJOGKVJQA-PCONQCKZSA-N |
| XLogP | 5.72 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.61 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|