C6H10O3 — CID 100937517
[(1R,2R,3S,4S)-3-(hydroxymethyl)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol (PubChem CID 100937517) has the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. Its IUPAC name is [(1R,2R,3S,4S)-3-(hydroxymethyl)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol.
| Compound Name | [(1R,2R,3S,4S)-3-(hydroxymethyl)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol |
|---|---|
| PubChem CID | 100937517 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | [(1R,2R,3S,4S)-3-(hydroxymethyl)-5-oxabicyclo[2.1.0]pentan-2-yl]methanol |
| SMILES | OC[C@@H]1[C@H](CO)[C@H]2O[C@@H]12 |
| InChI | InChI=1S/C6H10O3/c7-1-3-4(2-8)6-5(3)9-6/h3-8H,1-2H2/t3-,4+,5+,6- |
| InChIKey | XONWNORMXRUQQC-GUCUJZIJSA-N |
| XLogP | -1.02 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|