About benzyl (Z)-2-[(2,2,2-trifluoroacetyl)amino]but-2-enoate
benzyl (Z)-2-[(2,2,2-trifluoroacetyl)amino]but-2-enoate (PubChem CID 100937557) has the molecular formula C13H12F3NO3
and a molecular weight of 287.24 g/mol. Its IUPAC name is benzyl (Z)-2-[(2,2,2-trifluoroacetyl)amino]but-2-enoate.
Molecular Properties
| Compound Name | benzyl (Z)-2-[(2,2,2-trifluoroacetyl)amino]but-2-enoate |
| PubChem CID | 100937557 |
| Molecular Formula | C13H12F3NO3 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | benzyl (Z)-2-[(2,2,2-trifluoroacetyl)amino]but-2-enoate |
| SMILES | C/C=C(\NC(=O)C(F)(F)F)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H12F3NO3/c1-2-10(17-12(19)13(14,15)16)11(18)20-8-9-6-4-3-5-7-9/h2-7H,8H2,1H3,(H,17,19)/b10-2- |
| InChIKey | ZGAMLNRQQZPPEY-SGAXSIHGSA-N |
| XLogP | 2.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze benzyl (Z)-2-[(2,2,2-trifluoroacetyl)amino]but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (Z)-2-[(2,2,2-trifluoroacetyl)amino]but-2-enoate?
The IUPAC name of benzyl (Z)-2-[(2,2,2-trifluoroacetyl)amino]but-2-enoate (CID 100937557) is benzyl (Z)-2-[(2,2,2-trifluoroacetyl)amino]but-2-enoate.
What is the SMILES notation for benzyl (Z)-2-[(2,2,2-trifluoroacetyl)amino]but-2-enoate?
The canonical SMILES for benzyl (Z)-2-[(2,2,2-trifluoroacetyl)amino]but-2-enoate is C/C=C(\NC(=O)C(F)(F)F)C(=O)OCc1ccccc1.
What is the InChIKey of benzyl (Z)-2-[(2,2,2-trifluoroacetyl)amino]but-2-enoate?
The InChIKey is ZGAMLNRQQZPPEY-SGAXSIHGSA-N. The full InChI is InChI=1S/C13H12F3NO3/c1-2-10(17-12(19)13(14,15)16)11(18)20-8-9-6-4-3-5-7-9/h2-7H,8H2,1H3,(H,17,19)/b10-2-.
What are the key properties of benzyl (Z)-2-[(2,2,2-trifluoroacetyl)amino]but-2-enoate?
benzyl (Z)-2-[(2,2,2-trifluoroacetyl)amino]but-2-enoate has a molecular weight of 287.24 g/mol, XLogP of 2.31, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (Z)-2-[(2,2,2-trifluoroacetyl)amino]but-2-enoate is sourced from PubChem (CID 100937557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).