C26H48O4Si2 — CID 100937718
tert-butyl-[1-[(1S,5R,6R)-6-(methoxymethoxymethyl)-2-methyl-5-prop-1-en-2-yl-1-trimethylsilyloxycyclohex-3-en-1-yl]but-3-yn-2-yloxy]-dimethylsilane (PubChem CID 100937718) has the molecular formula C26H48O4Si2 and a molecular weight of 480.84 g/mol. Its IUPAC name is tert-butyl-[1-[(1S,5R,6R)-6-(methoxymethoxymethyl)-2-methyl-5-prop-1-en-2-yl-1-trimethylsilyloxycyclohex-3-en-1-yl]but-3-yn-2-yloxy]-dimethylsilane.
| Compound Name | tert-butyl-[1-[(1S,5R,6R)-6-(methoxymethoxymethyl)-2-methyl-5-prop-1-en-2-yl-1-trimethylsilyloxycyclohex-3-en-1-yl]but-3-yn-2-yloxy]-dimethylsilane |
|---|---|
| PubChem CID | 100937718 |
| Molecular Formula | C26H48O4Si2 |
| Molecular Weight | 480.84 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | tert-butyl-[1-[(1S,5R,6R)-6-(methoxymethoxymethyl)-2-methyl-5-prop-1-en-2-yl-1-trimethylsilyloxycyclohex-3-en-1-yl]but-3-yn-2-yloxy]-dimethylsilane |
| SMILES | C#CC(C[C@]1(O[Si](C)(C)C)C(C)C=CC(C(=C)C)[C@@H]1COCOC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H48O4Si2/c1-14-22(29-32(12,13)25(5,6)7)17-26(30-31(9,10)11)21(4)15-16-23(20(2)3)24(26)18-28-19-27-8/h1,15-16,21-24H,2,17-19H2,3-13H3/t21?,22?,23?,24-,26-/m0/s1 |
| InChIKey | TVVYAMVOJJTWKX-OCTSOESTSA-N |
| XLogP | 6.63 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.84 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|