C17H26O4 — CID 100937721
(3aR,4R,5R,7aS)-4-(methoxymethoxymethyl)-7a-methyl-1-methylidene-5-prop-1-en-2-yl-2,3,4,5-tetrahydroindene-2,3a-diol (PubChem CID 100937721) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is (3aR,4R,5R,7aS)-4-(methoxymethoxymethyl)-7a-methyl-1-methylidene-5-prop-1-en-2-yl-2,3,4,5-tetrahydroindene-2,3a-diol.
| Compound Name | (3aR,4R,5R,7aS)-4-(methoxymethoxymethyl)-7a-methyl-1-methylidene-5-prop-1-en-2-yl-2,3,4,5-tetrahydroindene-2,3a-diol |
|---|---|
| PubChem CID | 100937721 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | (3aR,4R,5R,7aS)-4-(methoxymethoxymethyl)-7a-methyl-1-methylidene-5-prop-1-en-2-yl-2,3,4,5-tetrahydroindene-2,3a-diol |
| SMILES | C=C(C)[C@@H]1C=C[C@@]2(C)C(=C)C(O)C[C@@]2(O)[C@H]1COCOC |
| InChI | InChI=1S/C17H26O4/c1-11(2)13-6-7-16(4)12(3)15(18)8-17(16,19)14(13)9-21-10-20-5/h6-7,13-15,18-19H,1,3,8-10H2,2,4-5H3/t13-,14-,15?,16-,17+/m0/s1 |
| InChIKey | KNIVQLCMLOBCAW-ZSNVMCELSA-N |
| XLogP | 2.04 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|