About CID 100937762
CID 100937762 (PubChem CID 100937762) has the molecular formula C16H19
and a molecular weight of 211.33 g/mol.
Molecular Properties
| Compound Name | CID 100937762 |
| PubChem CID | 100937762 |
| Molecular Formula | C16H19 |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.15 |
| IUPAC Name | — |
| SMILES | [c]1ccc(C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C16H19/c1-2-4-15(5-3-1)16-9-12-6-13(10-16)8-14(7-12)11-16/h2-5,12-14H,6-11H2 |
| InChIKey | VVTJNUBAJPFROU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 100937762 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 100937762?
The IUPAC name of CID 100937762 (CID 100937762) is not available.
What is the SMILES notation for CID 100937762?
The canonical SMILES for CID 100937762 is [c]1ccc(C23CC4CC(CC(C4)C2)C3)cc1.
What is the InChIKey of CID 100937762?
The InChIKey is VVTJNUBAJPFROU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19/c1-2-4-15(5-3-1)16-9-12-6-13(10-16)8-14(7-12)11-16/h2-5,12-14H,6-11H2.
What are the key properties of CID 100937762?
CID 100937762 has a molecular weight of 211.33 g/mol, XLogP of 3.95, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 100937762 is sourced from PubChem (CID 100937762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).