About 6-butyl-3-(dibutylamino)-6-hydroxynaphtho[3,2-b][1]benzofuran-11-one
6-butyl-3-(dibutylamino)-6-hydroxynaphtho[3,2-b][1]benzofuran-11-one (PubChem CID 100937796) has the molecular formula C28H35NO3
and a molecular weight of 433.59 g/mol. Its IUPAC name is 6-butyl-3-(dibutylamino)-6-hydroxynaphtho[3,2-b][1]benzofuran-11-one.
Molecular Properties
| Compound Name | 6-butyl-3-(dibutylamino)-6-hydroxynaphtho[3,2-b][1]benzofuran-11-one |
| PubChem CID | 100937796 |
| Molecular Formula | C28H35NO3 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | 6-butyl-3-(dibutylamino)-6-hydroxynaphtho[3,2-b][1]benzofuran-11-one |
| SMILES | CCCCN(CCCC)c1ccc2c3c(oc2c1)C(O)(CCCC)c1ccccc1C3=O |
| InChI | InChI=1S/C28H35NO3/c1-4-7-16-28(31)23-13-11-10-12-21(23)26(30)25-22-15-14-20(19-24(22)32-27(25)28)29(17-8-5-2)18-9-6-3/h10-15,19,31H,4-9,16-18H2,1-3H3 |
| InChIKey | XSFGEAMFEHQXKJ-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-butyl-3-(dibutylamino)-6-hydroxynaphtho[3,2-b][1]benzofuran-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butyl-3-(dibutylamino)-6-hydroxynaphtho[3,2-b][1]benzofuran-11-one?
The IUPAC name of 6-butyl-3-(dibutylamino)-6-hydroxynaphtho[3,2-b][1]benzofuran-11-one (CID 100937796) is 6-butyl-3-(dibutylamino)-6-hydroxynaphtho[3,2-b][1]benzofuran-11-one.
What is the SMILES notation for 6-butyl-3-(dibutylamino)-6-hydroxynaphtho[3,2-b][1]benzofuran-11-one?
The canonical SMILES for 6-butyl-3-(dibutylamino)-6-hydroxynaphtho[3,2-b][1]benzofuran-11-one is CCCCN(CCCC)c1ccc2c3c(oc2c1)C(O)(CCCC)c1ccccc1C3=O.
What is the InChIKey of 6-butyl-3-(dibutylamino)-6-hydroxynaphtho[3,2-b][1]benzofuran-11-one?
The InChIKey is XSFGEAMFEHQXKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H35NO3/c1-4-7-16-28(31)23-13-11-10-12-21(23)26(30)25-22-15-14-20(19-24(22)32-27(25)28)29(17-8-5-2)18-9-6-3/h10-15,19,31H,4-9,16-18H2,1-3H3.
What are the key properties of 6-butyl-3-(dibutylamino)-6-hydroxynaphtho[3,2-b][1]benzofuran-11-one?
6-butyl-3-(dibutylamino)-6-hydroxynaphtho[3,2-b][1]benzofuran-11-one has a molecular weight of 433.59 g/mol, XLogP of 6.81, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butyl-3-(dibutylamino)-6-hydroxynaphtho[3,2-b][1]benzofuran-11-one is sourced from PubChem (CID 100937796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).