C28H35NO3 — CID 100937796
6-butyl-3-(dibutylamino)-6-hydroxynaphtho[3,2-b][1]benzofuran-11-one (PubChem CID 100937796) has the molecular formula C28H35NO3 and a molecular weight of 433.59 g/mol. Its IUPAC name is 6-butyl-3-(dibutylamino)-6-hydroxynaphtho[3,2-b][1]benzofuran-11-one.
| Compound Name | 6-butyl-3-(dibutylamino)-6-hydroxynaphtho[3,2-b][1]benzofuran-11-one |
|---|---|
| PubChem CID | 100937796 |
| Molecular Formula | C28H35NO3 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | 6-butyl-3-(dibutylamino)-6-hydroxynaphtho[3,2-b][1]benzofuran-11-one |
| SMILES | CCCCN(CCCC)c1ccc2c3c(oc2c1)C(O)(CCCC)c1ccccc1C3=O |
| InChI | InChI=1S/C28H35NO3/c1-4-7-16-28(31)23-13-11-10-12-21(23)26(30)25-22-15-14-20(19-24(22)32-27(25)28)29(17-8-5-2)18-9-6-3/h10-15,19,31H,4-9,16-18H2,1-3H3 |
| InChIKey | XSFGEAMFEHQXKJ-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |