C23H35F3O4Si — CID 100938581
(8S,9S)-8-[(E)-5-[tert-butyl(dimethyl)silyl]oxy-3-methylpent-3-en-1-ynyl]-7,9-dimethyl-9-(trifluoromethyl)-1,4-dioxaspiro[4.5]dec-6-en-8-ol (PubChem CID 100938581) has the molecular formula C23H35F3O4Si and a molecular weight of 460.61 g/mol. Its IUPAC name is (8S,9S)-8-[(E)-5-[tert-butyl(dimethyl)silyl]oxy-3-methylpent-3-en-1-ynyl]-7,9-dimethyl-9-(trifluoromethyl)-1,4-dioxaspiro[4.5]dec-6-en-8-ol.
| Compound Name | (8S,9S)-8-[(E)-5-[tert-butyl(dimethyl)silyl]oxy-3-methylpent-3-en-1-ynyl]-7,9-dimethyl-9-(trifluoromethyl)-1,4-dioxaspiro[4.5]dec-6-en-8-ol |
|---|---|
| PubChem CID | 100938581 |
| Molecular Formula | C23H35F3O4Si |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | (8S,9S)-8-[(E)-5-[tert-butyl(dimethyl)silyl]oxy-3-methylpent-3-en-1-ynyl]-7,9-dimethyl-9-(trifluoromethyl)-1,4-dioxaspiro[4.5]dec-6-en-8-ol |
| SMILES | CC1=CC2(C[C@](C)(C(F)(F)F)[C@@]1(O)C#C/C(C)=C/CO[Si](C)(C)C(C)(C)C)OCCO2 |
| InChI | InChI=1S/C23H35F3O4Si/c1-17(10-12-30-31(7,8)19(3,4)5)9-11-22(27)18(2)15-21(28-13-14-29-21)16-20(22,6)23(24,25)26/h10,15,27H,12-14,16H2,1-8H3/b17-10+/t20-,22+/m0/s1 |
| InChIKey | ZXKSBSZHAKBBQE-MLIAMBGXSA-N |
| XLogP | 5.35 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|