C21H26O7 — CID 100938606
[(1E,3Z,4S,6E)-4-acetyloxy-3-(acetyloxymethylidene)-7,11-dimethyl-10-oxododeca-1,6-dien-8-ynyl] acetate (PubChem CID 100938606) has the molecular formula C21H26O7 and a molecular weight of 390.43 g/mol. Its IUPAC name is [(1E,3Z,4S,6E)-4-acetyloxy-3-(acetyloxymethylidene)-7,11-dimethyl-10-oxododeca-1,6-dien-8-ynyl] acetate.
| Compound Name | [(1E,3Z,4S,6E)-4-acetyloxy-3-(acetyloxymethylidene)-7,11-dimethyl-10-oxododeca-1,6-dien-8-ynyl] acetate |
|---|---|
| PubChem CID | 100938606 |
| Molecular Formula | C21H26O7 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | [(1E,3Z,4S,6E)-4-acetyloxy-3-(acetyloxymethylidene)-7,11-dimethyl-10-oxododeca-1,6-dien-8-ynyl] acetate |
| SMILES | CC(=O)O/C=C(/C=C/OC(C)=O)[C@H](C/C=C(\C)C#CC(=O)C(C)C)OC(C)=O |
| InChI | InChI=1S/C21H26O7/c1-14(2)20(25)9-7-15(3)8-10-21(28-18(6)24)19(13-27-17(5)23)11-12-26-16(4)22/h8,11-14,21H,10H2,1-6H3/b12-11+,15-8+,19-13-/t21-/m0/s1 |
| InChIKey | XSDSKPQAQDNQEY-JDULWRHYSA-N |
| XLogP | 3.01 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|