C7H12O2 — CID 100938649
(3R,4S,5S)-3,4,5-trimethyloxolan-2-one (PubChem CID 100938649) has the molecular formula C7H12O2 and a molecular weight of 128.17 g/mol. Its IUPAC name is (3R,4S,5S)-3,4,5-trimethyloxolan-2-one.
| Compound Name | (3R,4S,5S)-3,4,5-trimethyloxolan-2-one |
|---|---|
| PubChem CID | 100938649 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | (3R,4S,5S)-3,4,5-trimethyloxolan-2-one |
| SMILES | C[C@@H]1[C@H](C)OC(=O)[C@@H]1C |
| InChI | InChI=1S/C7H12O2/c1-4-5(2)7(8)9-6(4)3/h4-6H,1-3H3/t4-,5+,6-/m0/s1 |
| InChIKey | JZIORVLQWOYSTQ-JKUQZMGJSA-N |
| XLogP | 1.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |