C39H78Si7 — CID 100938802
dideuterio-[2,6-di(propan-2-yl)phenyl]-[2,4,6-tris[bis(trimethylsilyl)methyl]phenyl]silane (PubChem CID 100938802) has the molecular formula C39H78Si7 and a molecular weight of 745.67 g/mol. Its IUPAC name is dideuterio-[2,6-di(propan-2-yl)phenyl]-[2,4,6-tris[bis(trimethylsilyl)methyl]phenyl]silane.
| Compound Name | dideuterio-[2,6-di(propan-2-yl)phenyl]-[2,4,6-tris[bis(trimethylsilyl)methyl]phenyl]silane |
|---|---|
| PubChem CID | 100938802 |
| Molecular Formula | C39H78Si7 |
| Molecular Weight | 745.67 g/mol |
| Exact Mass | 744.46 |
| IUPAC Name | dideuterio-[2,6-di(propan-2-yl)phenyl]-[2,4,6-tris[bis(trimethylsilyl)methyl]phenyl]silane |
| SMILES | [2H][Si]([2H])(c1c(C(C)C)cccc1C(C)C)c1c(C([Si](C)(C)C)[Si](C)(C)C)cc(C([Si](C)(C)C)[Si](C)(C)C)cc1C([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C39H78Si7/c1-28(2)31-24-23-25-32(29(3)4)35(31)40-36-33(38(43(11,12)13)44(14,15)16)26-30(37(41(5,6)7)42(8,9)10)27-34(36)39(45(17,18)19)46(20,21)22/h23-29,37-39H,40H2,1-22H3/i40D2 |
| InChIKey | FHOFNSNLZRHYKA-WIFQZARFSA-N |
| XLogP | 11.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.67 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|