C14H21NO3Si — CID 100938985
trimethyl-[(6-phenyl-3a,4,6,6a-tetrahydro-3H-furo[3,4-c][1,2]oxazol-1-yl)oxy]silane (PubChem CID 100938985) has the molecular formula C14H21NO3Si and a molecular weight of 279.41 g/mol. Its IUPAC name is trimethyl-[(6-phenyl-3a,4,6,6a-tetrahydro-3H-furo[3,4-c][1,2]oxazol-1-yl)oxy]silane.
| Compound Name | trimethyl-[(6-phenyl-3a,4,6,6a-tetrahydro-3H-furo[3,4-c][1,2]oxazol-1-yl)oxy]silane |
|---|---|
| PubChem CID | 100938985 |
| Molecular Formula | C14H21NO3Si |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | trimethyl-[(6-phenyl-3a,4,6,6a-tetrahydro-3H-furo[3,4-c][1,2]oxazol-1-yl)oxy]silane |
| SMILES | C[Si](C)(C)ON1OCC2COC(c3ccccc3)C21 |
| InChI | InChI=1S/C14H21NO3Si/c1-19(2,3)18-15-13-12(10-17-15)9-16-14(13)11-7-5-4-6-8-11/h4-8,12-14H,9-10H2,1-3H3 |
| InChIKey | HHQVFCANCIUZCA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|