C12H11Cl2NO2 — CID 100938993
(3S,3aR,6R)-6-(2,4-dichlorophenyl)-3-methyl-3,3a,4,6-tetrahydrofuro[3,4-c][1,2]oxazole (PubChem CID 100938993) has the molecular formula C12H11Cl2NO2 and a molecular weight of 272.13 g/mol. Its IUPAC name is (3S,3aR,6R)-6-(2,4-dichlorophenyl)-3-methyl-3,3a,4,6-tetrahydrofuro[3,4-c][1,2]oxazole.
| Compound Name | (3S,3aR,6R)-6-(2,4-dichlorophenyl)-3-methyl-3,3a,4,6-tetrahydrofuro[3,4-c][1,2]oxazole |
|---|---|
| PubChem CID | 100938993 |
| Molecular Formula | C12H11Cl2NO2 |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | (3S,3aR,6R)-6-(2,4-dichlorophenyl)-3-methyl-3,3a,4,6-tetrahydrofuro[3,4-c][1,2]oxazole |
| SMILES | C[C@@H]1ON=C2[C@@H](c3ccc(Cl)cc3Cl)OC[C@@H]21 |
| InChI | InChI=1S/C12H11Cl2NO2/c1-6-9-5-16-12(11(9)15-17-6)8-3-2-7(13)4-10(8)14/h2-4,6,9,12H,5H2,1H3/t6-,9+,12+/m0/s1 |
| InChIKey | UOYOOXGJHIOLHS-PNLAZUSQSA-N |
| XLogP | 3.46 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |