C39H36N4O6 — CID 100939132
6-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)-13-octyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 100939132) has the molecular formula C39H36N4O6 and a molecular weight of 656.74 g/mol. Its IUPAC name is 6-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)-13-octyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)-13-octyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 100939132 |
| Molecular Formula | C39H36N4O6 |
| Molecular Weight | 656.74 g/mol |
| Exact Mass | 656.26 |
| IUPAC Name | 6-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)-13-octyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | CCCCCCCCN1C(=O)c2ccc3c4c(ccc(c24)C1=O)C(=O)N(N1C(=O)c2cccc4c(N5CCCCC5)ccc(c24)C1=O)C3=O |
| InChI | InChI=1S/C39H36N4O6/c1-2-3-4-5-6-10-22-41-34(44)26-14-16-28-33-29(17-15-27(32(26)33)35(41)45)39(49)43(38(28)48)42-36(46)24-13-11-12-23-30(40-20-8-7-9-21-40)19-18-25(31(23)24)37(42)47/h11-19H,2-10,20-22H2,1H3 |
| InChIKey | UQHCYWPIGBXMTM-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 115.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.74 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|