C36H52O9SSi — CID 100939309
methyl 4-[(2S,3R,4S,5S,6R)-3-acetyloxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(2-ethoxyethoxy)-4-prop-2-enoxyoxan-2-yl]sulfanylbutanoate (PubChem CID 100939309) has the molecular formula C36H52O9SSi and a molecular weight of 688.96 g/mol. Its IUPAC name is methyl 4-[(2S,3R,4S,5S,6R)-3-acetyloxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(2-ethoxyethoxy)-4-prop-2-enoxyoxan-2-yl]sulfanylbutanoate.
| Compound Name | methyl 4-[(2S,3R,4S,5S,6R)-3-acetyloxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(2-ethoxyethoxy)-4-prop-2-enoxyoxan-2-yl]sulfanylbutanoate |
|---|---|
| PubChem CID | 100939309 |
| Molecular Formula | C36H52O9SSi |
| Molecular Weight | 688.96 g/mol |
| Exact Mass | 688.31 |
| IUPAC Name | methyl 4-[(2S,3R,4S,5S,6R)-3-acetyloxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(2-ethoxyethoxy)-4-prop-2-enoxyoxan-2-yl]sulfanylbutanoate |
| SMILES | C=CCO[C@H]1[C@@H](OCCOCC)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@H](SCCCC(=O)OC)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C36H52O9SSi/c1-8-22-41-33-32(42-24-23-40-9-2)30(45-35(34(33)44-27(3)37)46-25-16-21-31(38)39-7)26-43-47(36(4,5)6,28-17-12-10-13-18-28)29-19-14-11-15-20-29/h8,10-15,17-20,30,32-35H,1,9,16,21-26H2,2-7H3/t30-,32+,33+,34-,35+/m1/s1 |
| InChIKey | IMKIZHNGJXDHDU-DNNCLPCDSA-N |
| XLogP | 4.90 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.96 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|