C16H24N4O5 — CID 100939440
ethyl (3R,4R,5S)-4-acetamido-5-azido-3-[(3R)-1-oxopentan-3-yl]oxycyclohexene-1-carboxylate (PubChem CID 100939440) has the molecular formula C16H24N4O5 and a molecular weight of 352.39 g/mol. Its IUPAC name is ethyl (3R,4R,5S)-4-acetamido-5-azido-3-[(3R)-1-oxopentan-3-yl]oxycyclohexene-1-carboxylate.
| Compound Name | ethyl (3R,4R,5S)-4-acetamido-5-azido-3-[(3R)-1-oxopentan-3-yl]oxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 100939440 |
| Molecular Formula | C16H24N4O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | ethyl (3R,4R,5S)-4-acetamido-5-azido-3-[(3R)-1-oxopentan-3-yl]oxycyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=C[C@@H](O[C@H](CC)CC=O)[C@H](NC(C)=O)[C@@H](N=[N+]=[N-])C1 |
| InChI | InChI=1S/C16H24N4O5/c1-4-12(6-7-21)25-14-9-11(16(23)24-5-2)8-13(19-20-17)15(14)18-10(3)22/h7,9,12-15H,4-6,8H2,1-3H3,(H,18,22)/t12-,13+,14-,15-/m1/s1 |
| InChIKey | AVJKTHAQPHIMKG-LXTVHRRPSA-N |
| XLogP | 1.82 |
| TPSA | 130.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|