C17H26O10 — CID 100939783
3-O-[[(4R,5R)-5-[(3-ethoxy-3-oxopropanoyl)oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl] 1-O-ethyl propanedioate (PubChem CID 100939783) has the molecular formula C17H26O10 and a molecular weight of 390.39 g/mol. Its IUPAC name is 3-O-[[(4R,5R)-5-[(3-ethoxy-3-oxopropanoyl)oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl] 1-O-ethyl propanedioate.
| Compound Name | 3-O-[[(4R,5R)-5-[(3-ethoxy-3-oxopropanoyl)oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl] 1-O-ethyl propanedioate |
|---|---|
| PubChem CID | 100939783 |
| Molecular Formula | C17H26O10 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 3-O-[[(4R,5R)-5-[(3-ethoxy-3-oxopropanoyl)oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl] 1-O-ethyl propanedioate |
| SMILES | CCOC(=O)CC(=O)OC[C@H]1OC(C)(C)O[C@@H]1COC(=O)CC(=O)OCC |
| InChI | InChI=1S/C17H26O10/c1-5-22-13(18)7-15(20)24-9-11-12(27-17(3,4)26-11)10-25-16(21)8-14(19)23-6-2/h11-12H,5-10H2,1-4H3/t11-,12-/m1/s1 |
| InChIKey | BWIXRGFIDMLRGK-VXGBXAGGSA-N |
| XLogP | 0.50 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|