C18H20S2 — CID 100939879
3,12-dithiatricyclo[13.2.2.16,10]icosa-1(18),6(20),7,9,15(19),16-hexaene (PubChem CID 100939879) has the molecular formula C18H20S2 and a molecular weight of 300.49 g/mol. Its IUPAC name is 3,12-dithiatricyclo[13.2.2.16,10]icosa-1(18),6(20),7,9,15(19),16-hexaene.
| Compound Name | 3,12-dithiatricyclo[13.2.2.16,10]icosa-1(18),6(20),7,9,15(19),16-hexaene |
|---|---|
| PubChem CID | 100939879 |
| Molecular Formula | C18H20S2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 3,12-dithiatricyclo[13.2.2.16,10]icosa-1(18),6(20),7,9,15(19),16-hexaene |
| SMILES | c1cc2cc(c1)CSCCc1ccc(cc1)CSCC2 |
| InChI | InChI=1S/C18H20S2/c1-2-16-9-11-19-13-17-6-4-15(5-7-17)8-10-20-14-18(3-1)12-16/h1-7,12H,8-11,13-14H2 |
| InChIKey | GPQBYEKMECJFKA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |