About (1S,5R)-3-methoxy-1,5-dimethyl-7-phenyl-3-borabicyclo[3.3.1]nonane
(1S,5R)-3-methoxy-1,5-dimethyl-7-phenyl-3-borabicyclo[3.3.1]nonane (PubChem CID 100940021) has the molecular formula C17H25BO
and a molecular weight of 256.20 g/mol. Its IUPAC name is (1S,5R)-3-methoxy-1,5-dimethyl-7-phenyl-3-borabicyclo[3.3.1]nonane.
Molecular Properties
| Compound Name | (1S,5R)-3-methoxy-1,5-dimethyl-7-phenyl-3-borabicyclo[3.3.1]nonane |
| PubChem CID | 100940021 |
| Molecular Formula | C17H25BO |
| Molecular Weight | 256.20 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | (1S,5R)-3-methoxy-1,5-dimethyl-7-phenyl-3-borabicyclo[3.3.1]nonane |
| SMILES | COB1C[C@@]2(C)CC(c3ccccc3)C[C@@](C)(C1)C2 |
| InChI | InChI=1S/C17H25BO/c1-16-9-15(14-7-5-4-6-8-14)10-17(2,11-16)13-18(12-16)19-3/h4-8,15H,9-13H2,1-3H3/t15?,16-,17+ |
| InChIKey | APUXARVPRNIZEW-ALOPSCKCSA-N |
| XLogP | 4.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.20 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (1S,5R)-3-methoxy-1,5-dimethyl-7-phenyl-3-borabicyclo[3.3.1]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5R)-3-methoxy-1,5-dimethyl-7-phenyl-3-borabicyclo[3.3.1]nonane?
The IUPAC name of (1S,5R)-3-methoxy-1,5-dimethyl-7-phenyl-3-borabicyclo[3.3.1]nonane (CID 100940021) is (1S,5R)-3-methoxy-1,5-dimethyl-7-phenyl-3-borabicyclo[3.3.1]nonane.
What is the SMILES notation for (1S,5R)-3-methoxy-1,5-dimethyl-7-phenyl-3-borabicyclo[3.3.1]nonane?
The canonical SMILES for (1S,5R)-3-methoxy-1,5-dimethyl-7-phenyl-3-borabicyclo[3.3.1]nonane is COB1C[C@@]2(C)CC(c3ccccc3)C[C@@](C)(C1)C2.
What is the InChIKey of (1S,5R)-3-methoxy-1,5-dimethyl-7-phenyl-3-borabicyclo[3.3.1]nonane?
The InChIKey is APUXARVPRNIZEW-ALOPSCKCSA-N. The full InChI is InChI=1S/C17H25BO/c1-16-9-15(14-7-5-4-6-8-14)10-17(2,11-16)13-18(12-16)19-3/h4-8,15H,9-13H2,1-3H3/t15?,16-,17+.
What are the key properties of (1S,5R)-3-methoxy-1,5-dimethyl-7-phenyl-3-borabicyclo[3.3.1]nonane?
(1S,5R)-3-methoxy-1,5-dimethyl-7-phenyl-3-borabicyclo[3.3.1]nonane has a molecular weight of 256.20 g/mol, XLogP of 4.62, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5R)-3-methoxy-1,5-dimethyl-7-phenyl-3-borabicyclo[3.3.1]nonane is sourced from PubChem (CID 100940021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).