C24H29NO6 — CID 10094050
(3S,4R)-1-benzyl-4-[(4R,5R)-5-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-phenylmethoxyazetidin-2-one (PubChem CID 10094050) has the molecular formula C24H29NO6 and a molecular weight of 427.50 g/mol. Its IUPAC name is (3S,4R)-1-benzyl-4-[(4R,5R)-5-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-phenylmethoxyazetidin-2-one.
| Compound Name | (3S,4R)-1-benzyl-4-[(4R,5R)-5-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-phenylmethoxyazetidin-2-one |
|---|---|
| PubChem CID | 10094050 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | (3S,4R)-1-benzyl-4-[(4R,5R)-5-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-phenylmethoxyazetidin-2-one |
| SMILES | CC1(C)O[C@H]([C@@H]2[C@H](OCc3ccccc3)C(=O)N2Cc2ccccc2)[C@@H]([C@H](O)CO)O1 |
| InChI | InChI=1S/C24H29NO6/c1-24(2)30-20(18(27)14-26)21(31-24)19-22(29-15-17-11-7-4-8-12-17)23(28)25(19)13-16-9-5-3-6-10-16/h3-12,18-22,26-27H,13-15H2,1-2H3/t18-,19-,20-,21-,22+/m1/s1 |
| InChIKey | BPXJENKVPPEWEI-LMYCIYFBSA-N |
| XLogP | 1.86 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |