C32H16O2 — CID 100940950
8,9-dimethoxytetracyclo[24.4.0.06,11.016,21]triaconta-1,2,3,4,5,7,9,11,12,13,14,15,17,19,21,22,23,24,25,27,29-henicosaene (PubChem CID 100940950) has the molecular formula C32H16O2 and a molecular weight of 432.48 g/mol. Its IUPAC name is 8,9-dimethoxytetracyclo[24.4.0.06,11.016,21]triaconta-1,2,3,4,5,7,9,11,12,13,14,15,17,19,21,22,23,24,25,27,29-henicosaene.
| Compound Name | 8,9-dimethoxytetracyclo[24.4.0.06,11.016,21]triaconta-1,2,3,4,5,7,9,11,12,13,14,15,17,19,21,22,23,24,25,27,29-henicosaene |
|---|---|
| PubChem CID | 100940950 |
| Molecular Formula | C32H16O2 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 8,9-dimethoxytetracyclo[24.4.0.06,11.016,21]triaconta-1,2,3,4,5,7,9,11,12,13,14,15,17,19,21,22,23,24,25,27,29-henicosaene |
| SMILES | COc1cc2c(cc1OC)=C=C=C=C=c1ccccc1=C=C=C=C=c1ccccc1=C=C=C=C=2 |
| InChI | InChI=1S/C32H16O2/c1-33-31-23-29-21-11-9-19-27-17-7-5-15-25(27)13-3-4-14-26-16-6-8-18-28(26)20-10-12-22-30(29)24-32(31)34-2/h5-8,15-18,23-24H,1-2H3 |
| InChIKey | XOAVTUHFKMLNMV-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |