C46H44O2 — CID 100940951
8,9-dioctoxytetracyclo[24.4.0.06,11.016,21]triaconta-1,2,3,4,5,7,9,11,12,13,14,15,17,19,21,22,23,24,25,27,29-henicosaene (PubChem CID 100940951) has the molecular formula C46H44O2 and a molecular weight of 628.86 g/mol. Its IUPAC name is 8,9-dioctoxytetracyclo[24.4.0.06,11.016,21]triaconta-1,2,3,4,5,7,9,11,12,13,14,15,17,19,21,22,23,24,25,27,29-henicosaene.
| Compound Name | 8,9-dioctoxytetracyclo[24.4.0.06,11.016,21]triaconta-1,2,3,4,5,7,9,11,12,13,14,15,17,19,21,22,23,24,25,27,29-henicosaene |
|---|---|
| PubChem CID | 100940951 |
| Molecular Formula | C46H44O2 |
| Molecular Weight | 628.86 g/mol |
| Exact Mass | 628.33 |
| IUPAC Name | 8,9-dioctoxytetracyclo[24.4.0.06,11.016,21]triaconta-1,2,3,4,5,7,9,11,12,13,14,15,17,19,21,22,23,24,25,27,29-henicosaene |
| SMILES | CCCCCCCCOc1cc2c(cc1OCCCCCCCC)=C=C=C=C=c1ccccc1=C=C=C=C=c1ccccc1=C=C=C=C=2 |
| InChI | InChI=1S/C46H44O2/c1-3-5-7-9-11-23-35-47-45-37-43-33-21-19-31-41-29-17-15-27-39(41)25-13-14-26-40-28-16-18-30-42(40)32-20-22-34-44(43)38-46(45)48-36-24-12-10-8-6-4-2/h15-18,27-30,37-38H,3-12,23-24,35-36H2,1-2H3 |
| InChIKey | JIYPIBYHYSKLIH-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.86 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|