C15H27BrO3SiZn — CID 10094118
bromozinc(1+);3-(2-methoxyethoxymethoxy)octa-1,2,7-trienyl-trimethylsilane (PubChem CID 10094118) has the molecular formula C15H27BrO3SiZn and a molecular weight of 428.76 g/mol. Its IUPAC name is bromozinc(1+);3-(2-methoxyethoxymethoxy)octa-1,2,7-trienyl-trimethylsilane.
| Compound Name | bromozinc(1+);3-(2-methoxyethoxymethoxy)octa-1,2,7-trienyl-trimethylsilane |
|---|---|
| PubChem CID | 10094118 |
| Molecular Formula | C15H27BrO3SiZn |
| Molecular Weight | 428.76 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | bromozinc(1+);3-(2-methoxyethoxymethoxy)octa-1,2,7-trienyl-trimethylsilane |
| SMILES | C=CCCCC(=C=[C-][Si](C)(C)C)OCOCCOC.[Zn+]Br |
| InChI | InChI=1S/C15H27O3Si.BrH.Zn/c1-6-7-8-9-15(10-13-19(3,4)5)18-14-17-12-11-16-2;;/h6H,1,7-9,11-12,14H2,2-5H3;1H;/q-1;;+2/p-1 |
| InChIKey | FRJMZVJREULIAC-UHFFFAOYSA-M |
| XLogP | 4.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.76 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|