C32H44N3O2PSi — CID 100941303
(3aS,7aS)-N,1,3-trimethyl-2-oxido-N-(1,2,2-triphenyl-2-trimethylsilyloxyethyl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-ium-2-amine (PubChem CID 100941303) has the molecular formula C32H44N3O2PSi and a molecular weight of 561.78 g/mol. Its IUPAC name is (3aS,7aS)-N,1,3-trimethyl-2-oxido-N-(1,2,2-triphenyl-2-trimethylsilyloxyethyl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-ium-2-amine.
| Compound Name | (3aS,7aS)-N,1,3-trimethyl-2-oxido-N-(1,2,2-triphenyl-2-trimethylsilyloxyethyl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-ium-2-amine |
|---|---|
| PubChem CID | 100941303 |
| Molecular Formula | C32H44N3O2PSi |
| Molecular Weight | 561.78 g/mol |
| Exact Mass | 561.29 |
| IUPAC Name | (3aS,7aS)-N,1,3-trimethyl-2-oxido-N-(1,2,2-triphenyl-2-trimethylsilyloxyethyl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-ium-2-amine |
| SMILES | CN(C(c1ccccc1)C(O[Si](C)(C)C)(c1ccccc1)c1ccccc1)[P+]1([O-])N(C)[C@H]2CCCC[C@@H]2N1C |
| InChI | InChI=1S/C32H44N3O2PSi/c1-33-29-24-16-17-25-30(29)34(2)38(33,36)35(3)31(26-18-10-7-11-19-26)32(37-39(4,5)6,27-20-12-8-13-21-27)28-22-14-9-15-23-28/h7-15,18-23,29-31H,16-17,24-25H2,1-6H3/t29-,30-,31?/m0/s1 |
| InChIKey | FHCWQIHNPQUXIC-XPZBDPFPSA-N |
| XLogP | 6.68 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.78 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|