C22H32 — CID 100941388
2,2,3,3,8,8,9,9-octamethyltricyclo[8.2.1.14,7]tetradeca-1(13),5,7(14),11-tetraene (PubChem CID 100941388) has the molecular formula C22H32 and a molecular weight of 296.50 g/mol. Its IUPAC name is 2,2,3,3,8,8,9,9-octamethyltricyclo[8.2.1.14,7]tetradeca-1(13),5,7(14),11-tetraene.
| Compound Name | 2,2,3,3,8,8,9,9-octamethyltricyclo[8.2.1.14,7]tetradeca-1(13),5,7(14),11-tetraene |
|---|---|
| PubChem CID | 100941388 |
| Molecular Formula | C22H32 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | 2,2,3,3,8,8,9,9-octamethyltricyclo[8.2.1.14,7]tetradeca-1(13),5,7(14),11-tetraene |
| SMILES | CC1(C)C2=CC(C=C2)C(C)(C)C(C)(C)C2=CC(C=C2)C1(C)C |
| InChI | InChI=1S/C22H32/c1-19(2)15-9-10-17(13-15)21(5,6)22(7,8)18-12-11-16(14-18)20(19,3)4/h9-15,18H,1-8H3 |
| InChIKey | IUJGAUWOTNRGTK-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |