C17H19N — CID 100941432
(2R,3R)-1-ethyl-2,3-diphenylazetidine (PubChem CID 100941432) has the molecular formula C17H19N and a molecular weight of 237.35 g/mol. Its IUPAC name is (2R,3R)-1-ethyl-2,3-diphenylazetidine.
| Compound Name | (2R,3R)-1-ethyl-2,3-diphenylazetidine |
|---|---|
| PubChem CID | 100941432 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | (2R,3R)-1-ethyl-2,3-diphenylazetidine |
| SMILES | CCN1C[C@@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H19N/c1-2-18-13-16(14-9-5-3-6-10-14)17(18)15-11-7-4-8-12-15/h3-12,16-17H,2,13H2,1H3/t16-,17-/m0/s1 |
| InChIKey | KOCGMAWSLSYXFJ-IRXDYDNUSA-N |
| XLogP | 3.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |