About (2R,3R)-1-ethyl-2,3-diphenylazetidine
(2R,3R)-1-ethyl-2,3-diphenylazetidine (PubChem CID 100941432) has the molecular formula C17H19N
and a molecular weight of 237.35 g/mol. Its IUPAC name is (2R,3R)-1-ethyl-2,3-diphenylazetidine.
Molecular Properties
| Compound Name | (2R,3R)-1-ethyl-2,3-diphenylazetidine |
| PubChem CID | 100941432 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | (2R,3R)-1-ethyl-2,3-diphenylazetidine |
| SMILES | CCN1C[C@@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H19N/c1-2-18-13-16(14-9-5-3-6-10-14)17(18)15-11-7-4-8-12-15/h3-12,16-17H,2,13H2,1H3/t16-,17-/m0/s1 |
| InChIKey | KOCGMAWSLSYXFJ-IRXDYDNUSA-N |
| XLogP | 3.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R,3R)-1-ethyl-2,3-diphenylazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-1-ethyl-2,3-diphenylazetidine?
The IUPAC name of (2R,3R)-1-ethyl-2,3-diphenylazetidine (CID 100941432) is (2R,3R)-1-ethyl-2,3-diphenylazetidine.
What is the SMILES notation for (2R,3R)-1-ethyl-2,3-diphenylazetidine?
The canonical SMILES for (2R,3R)-1-ethyl-2,3-diphenylazetidine is CCN1C[C@@H](c2ccccc2)[C@@H]1c1ccccc1.
What is the InChIKey of (2R,3R)-1-ethyl-2,3-diphenylazetidine?
The InChIKey is KOCGMAWSLSYXFJ-IRXDYDNUSA-N. The full InChI is InChI=1S/C17H19N/c1-2-18-13-16(14-9-5-3-6-10-14)17(18)15-11-7-4-8-12-15/h3-12,16-17H,2,13H2,1H3/t16-,17-/m0/s1.
What are the key properties of (2R,3R)-1-ethyl-2,3-diphenylazetidine?
(2R,3R)-1-ethyl-2,3-diphenylazetidine has a molecular weight of 237.35 g/mol, XLogP of 3.85, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-1-ethyl-2,3-diphenylazetidine is sourced from PubChem (CID 100941432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).