C21H33N3O12 — CID 100941710
7,16,25-trimethyl-1,4,10,13,19,22-hexaoxa-7,16,25-triazacycloheptacosane-5,9,14,18,23,27-hexone (PubChem CID 100941710) has the molecular formula C21H33N3O12 and a molecular weight of 519.50 g/mol. Its IUPAC name is 7,16,25-trimethyl-1,4,10,13,19,22-hexaoxa-7,16,25-triazacycloheptacosane-5,9,14,18,23,27-hexone.
| Compound Name | 7,16,25-trimethyl-1,4,10,13,19,22-hexaoxa-7,16,25-triazacycloheptacosane-5,9,14,18,23,27-hexone |
|---|---|
| PubChem CID | 100941710 |
| Molecular Formula | C21H33N3O12 |
| Molecular Weight | 519.50 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | 7,16,25-trimethyl-1,4,10,13,19,22-hexaoxa-7,16,25-triazacycloheptacosane-5,9,14,18,23,27-hexone |
| SMILES | CN1CC(=O)OCCOC(=O)CN(C)CC(=O)OCCOC(=O)CN(C)CC(=O)OCCOC(=O)C1 |
| InChI | InChI=1S/C21H33N3O12/c1-22-10-16(25)31-4-6-33-18(27)12-23(2)14-20(29)35-8-9-36-21(30)15-24(3)13-19(28)34-7-5-32-17(26)11-22/h4-15H2,1-3H3 |
| InChIKey | ODRRSGJDXOUIJD-UHFFFAOYSA-N |
| XLogP | -2.95 |
| TPSA | 167.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.50 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|