C28H29NO4 — CID 100941760
(1R,4S,8R,11S)-17,18-dimethylidene-6-phenylspiro[13,15-dioxa-6-azapentacyclo[9.5.2.01,11.02,10.04,8]octadec-2(10)-ene-14,1'-cyclohexane]-5,7-dione (PubChem CID 100941760) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is (1R,4S,8R,11S)-17,18-dimethylidene-6-phenylspiro[13,15-dioxa-6-azapentacyclo[9.5.2.01,11.02,10.04,8]octadec-2(10)-ene-14,1'-cyclohexane]-5,7-dione.
| Compound Name | (1R,4S,8R,11S)-17,18-dimethylidene-6-phenylspiro[13,15-dioxa-6-azapentacyclo[9.5.2.01,11.02,10.04,8]octadec-2(10)-ene-14,1'-cyclohexane]-5,7-dione |
|---|---|
| PubChem CID | 100941760 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | (1R,4S,8R,11S)-17,18-dimethylidene-6-phenylspiro[13,15-dioxa-6-azapentacyclo[9.5.2.01,11.02,10.04,8]octadec-2(10)-ene-14,1'-cyclohexane]-5,7-dione |
| SMILES | C=C1C(=C)[C@@]23COC4(CCCCC4)OC[C@@]12C1=C3C[C@H]2C(=O)N(c3ccccc3)C(=O)[C@H]2C1 |
| InChI | InChI=1S/C28H29NO4/c1-17-18(2)28-16-33-26(11-7-4-8-12-26)32-15-27(17,28)22-13-20-21(14-23(22)28)25(31)29(24(20)30)19-9-5-3-6-10-19/h3,5-6,9-10,20-21H,1-2,4,7-8,11-16H2/t20-,21+,27-,28+ |
| InChIKey | BIKVRDVHZMJKCV-KBVUCLSESA-N |
| XLogP | 4.70 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|