C35H48O5SSi2 — CID 100941794
[(2R,3S)-2-[[(2S,3R)-2-(benzenesulfonyl)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxiran-2-yl]methyl]-3-methyloxan-3-yl]-trimethylsilane (PubChem CID 100941794) has the molecular formula C35H48O5SSi2 and a molecular weight of 637.00 g/mol. Its IUPAC name is [(2R,3S)-2-[[(2S,3R)-2-(benzenesulfonyl)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxiran-2-yl]methyl]-3-methyloxan-3-yl]-trimethylsilane.
| Compound Name | [(2R,3S)-2-[[(2S,3R)-2-(benzenesulfonyl)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxiran-2-yl]methyl]-3-methyloxan-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 100941794 |
| Molecular Formula | C35H48O5SSi2 |
| Molecular Weight | 637.00 g/mol |
| Exact Mass | 636.28 |
| IUPAC Name | [(2R,3S)-2-[[(2S,3R)-2-(benzenesulfonyl)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxiran-2-yl]methyl]-3-methyloxan-3-yl]-trimethylsilane |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@@]1(C[C@H]1OCCC[C@]1(C)[Si](C)(C)C)S(=O)(=O)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H48O5SSi2/c1-33(2,3)43(29-20-13-9-14-21-29,30-22-15-10-16-23-30)39-27-32-35(40-32,41(36,37)28-18-11-8-12-19-28)26-31-34(4,42(5,6)7)24-17-25-38-31/h8-16,18-23,31-32H,17,24-27H2,1-7H3/t31-,32-,34+,35+/m1/s1 |
| InChIKey | DAJGXHSAQTXHGU-UBMXHKEWSA-N |
| XLogP | 6.80 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.00 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|