C12H14O4 — CID 100941810
(1R,6R,9R,12S)-12-(hydroxymethyl)-8,13-dioxatricyclo[7.4.0.02,6]trideca-2,10-dien-4-one (PubChem CID 100941810) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is (1R,6R,9R,12S)-12-(hydroxymethyl)-8,13-dioxatricyclo[7.4.0.02,6]trideca-2,10-dien-4-one.
| Compound Name | (1R,6R,9R,12S)-12-(hydroxymethyl)-8,13-dioxatricyclo[7.4.0.02,6]trideca-2,10-dien-4-one |
|---|---|
| PubChem CID | 100941810 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (1R,6R,9R,12S)-12-(hydroxymethyl)-8,13-dioxatricyclo[7.4.0.02,6]trideca-2,10-dien-4-one |
| SMILES | O=C1C=C2[C@H](CO[C@@H]3C=C[C@@H](CO)O[C@H]23)C1 |
| InChI | InChI=1S/C12H14O4/c13-5-9-1-2-11-12(16-9)10-4-8(14)3-7(10)6-15-11/h1-2,4,7,9,11-13H,3,5-6H2/t7-,9-,11+,12+/m0/s1 |
| InChIKey | BRRBGVKNALUWRM-DFJQSBMWSA-N |
| XLogP | 0.22 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|