C18H28N4O7 — CID 100941829
(2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 100941829) has the molecular formula C18H28N4O7 and a molecular weight of 412.44 g/mol. Its IUPAC name is (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 100941829 |
| Molecular Formula | C18H28N4O7 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | (2S)-2-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | Cc1cn(CC(=O)N[C@@H](CCCCNC(=O)OC(C)(C)C)C(=O)O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H28N4O7/c1-11-9-22(16(27)21-14(11)24)10-13(23)20-12(15(25)26)7-5-6-8-19-17(28)29-18(2,3)4/h9,12H,5-8,10H2,1-4H3,(H,19,28)(H,20,23)(H,25,26)(H,21,24,27)/t12-/m0/s1 |
| InChIKey | FEWZBVFXUNAMKL-LBPRGKRZSA-N |
| XLogP | 0.11 |
| TPSA | 159.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|