C18H16N2O5 — CID 100941850
1,3-dibenzyl-5,5-dihydroxy-1,3-diazinane-2,4,6-trione (PubChem CID 100941850) has the molecular formula C18H16N2O5 and a molecular weight of 340.33 g/mol. Its IUPAC name is 1,3-dibenzyl-5,5-dihydroxy-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dibenzyl-5,5-dihydroxy-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 100941850 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 1,3-dibenzyl-5,5-dihydroxy-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1N(Cc2ccccc2)C(=O)C(O)(O)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H16N2O5/c21-15-18(24,25)16(22)20(12-14-9-5-2-6-10-14)17(23)19(15)11-13-7-3-1-4-8-13/h1-10,24-25H,11-12H2 |
| InChIKey | NXASFCHCYLNGQI-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|