C20H25N3O — CID 100942165
(2S)-2-[(1S,2R,10R,12S,13S,14S,17R)-17-hydroxy-3-methyl-3,16-diazapentacyclo[10.3.1.110,13.02,10.04,9]heptadeca-4,6,8-trien-14-yl]butanenitrile (PubChem CID 100942165) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is (2S)-2-[(1S,2R,10R,12S,13S,14S,17R)-17-hydroxy-3-methyl-3,16-diazapentacyclo[10.3.1.110,13.02,10.04,9]heptadeca-4,6,8-trien-14-yl]butanenitrile.
| Compound Name | (2S)-2-[(1S,2R,10R,12S,13S,14S,17R)-17-hydroxy-3-methyl-3,16-diazapentacyclo[10.3.1.110,13.02,10.04,9]heptadeca-4,6,8-trien-14-yl]butanenitrile |
|---|---|
| PubChem CID | 100942165 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | (2S)-2-[(1S,2R,10R,12S,13S,14S,17R)-17-hydroxy-3-methyl-3,16-diazapentacyclo[10.3.1.110,13.02,10.04,9]heptadeca-4,6,8-trien-14-yl]butanenitrile |
| SMILES | CC[C@H](C#N)[C@@H]1C[C@@H]2N[C@H]3C[C@]4(c5ccccc5N(C)[C@@H]24)[C@H](O)[C@@H]13 |
| InChI | InChI=1S/C20H25N3O/c1-3-11(10-21)12-8-14-18-20(9-15(22-14)17(12)19(20)24)13-6-4-5-7-16(13)23(18)2/h4-7,11-12,14-15,17-19,22,24H,3,8-9H2,1-2H3/t11-,12+,14+,15+,17+,18+,19-,20-/m1/s1 |
| InChIKey | XKHSJHYHCWNRFW-XXHRDQNBSA-N |
| XLogP | 2.03 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |