C24H52O4Si3 — CID 100942173
triethyl-[[(2R,3S,4S)-3-triethylsilyloxy-2-(triethylsilyloxymethyl)-3,4-dihydro-2H-pyran-4-yl]oxy]silane (PubChem CID 100942173) has the molecular formula C24H52O4Si3 and a molecular weight of 488.93 g/mol. Its IUPAC name is triethyl-[[(2R,3S,4S)-3-triethylsilyloxy-2-(triethylsilyloxymethyl)-3,4-dihydro-2H-pyran-4-yl]oxy]silane.
| Compound Name | triethyl-[[(2R,3S,4S)-3-triethylsilyloxy-2-(triethylsilyloxymethyl)-3,4-dihydro-2H-pyran-4-yl]oxy]silane |
|---|---|
| PubChem CID | 100942173 |
| Molecular Formula | C24H52O4Si3 |
| Molecular Weight | 488.93 g/mol |
| Exact Mass | 488.32 |
| IUPAC Name | triethyl-[[(2R,3S,4S)-3-triethylsilyloxy-2-(triethylsilyloxymethyl)-3,4-dihydro-2H-pyran-4-yl]oxy]silane |
| SMILES | CC[Si](CC)(CC)OC[C@H]1OC=C[C@H](O[Si](CC)(CC)CC)[C@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C24H52O4Si3/c1-10-29(11-2,12-3)26-21-23-24(28-31(16-7,17-8)18-9)22(19-20-25-23)27-30(13-4,14-5)15-6/h19-20,22-24H,10-18,21H2,1-9H3/t22-,23+,24+/m0/s1 |
| InChIKey | XSAVXVFJKZSORO-RBZQAINGSA-N |
| XLogP | 7.70 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.93 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|