C25H26N4O3 — CID 10094219
methyl (2R,3R)-2-[(3-carbamimidoylphenyl)methyl]-3-[(4-pyridin-4-ylbenzoyl)amino]butanoate (PubChem CID 10094219) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is methyl (2R,3R)-2-[(3-carbamimidoylphenyl)methyl]-3-[(4-pyridin-4-ylbenzoyl)amino]butanoate.
| Compound Name | methyl (2R,3R)-2-[(3-carbamimidoylphenyl)methyl]-3-[(4-pyridin-4-ylbenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 10094219 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | methyl (2R,3R)-2-[(3-carbamimidoylphenyl)methyl]-3-[(4-pyridin-4-ylbenzoyl)amino]butanoate |
| SMILES | [H]/N=C(\N)c1cccc(C[C@@H](C(=O)OC)[C@@H](C)NC(=O)c2ccc(-c3ccncc3)cc2)c1 |
| InChI | InChI=1S/C25H26N4O3/c1-16(22(25(31)32-2)15-17-4-3-5-21(14-17)23(26)27)29-24(30)20-8-6-18(7-9-20)19-10-12-28-13-11-19/h3-14,16,22H,15H2,1-2H3,(H3,26,27)(H,29,30)/t16-,22-/m1/s1 |
| InChIKey | GRCGTSQMJBJUHW-OPAMFIHVSA-N |
| XLogP | 3.18 |
| TPSA | 118.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|