C28H37NOSi — CID 10094306
N-[[3-[[dimethyl-(2-methylphenyl)silyl]methoxy]phenyl]methyl]-N-ethyl-6,6-dimethylhepta-2,4-diyn-1-amine (PubChem CID 10094306) has the molecular formula C28H37NOSi and a molecular weight of 431.70 g/mol. Its IUPAC name is N-[[3-[[dimethyl-(2-methylphenyl)silyl]methoxy]phenyl]methyl]-N-ethyl-6,6-dimethylhepta-2,4-diyn-1-amine.
| Compound Name | N-[[3-[[dimethyl-(2-methylphenyl)silyl]methoxy]phenyl]methyl]-N-ethyl-6,6-dimethylhepta-2,4-diyn-1-amine |
|---|---|
| PubChem CID | 10094306 |
| Molecular Formula | C28H37NOSi |
| Molecular Weight | 431.70 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | N-[[3-[[dimethyl-(2-methylphenyl)silyl]methoxy]phenyl]methyl]-N-ethyl-6,6-dimethylhepta-2,4-diyn-1-amine |
| SMILES | CCN(CC#CC#CC(C)(C)C)Cc1cccc(OC[Si](C)(C)c2ccccc2C)c1 |
| InChI | InChI=1S/C28H37NOSi/c1-8-29(20-13-9-12-19-28(3,4)5)22-25-16-14-17-26(21-25)30-23-31(6,7)27-18-11-10-15-24(27)2/h10-11,14-18,21H,8,20,22-23H2,1-7H3 |
| InChIKey | USOJQQZZCHMWNX-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.70 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|