C29H40N2O — CID 100943426
(8R,9S,10S,13S,14S,17E)-17-[2-[4-(dimethylamino)phenyl]iminoethylidene]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-16-one (PubChem CID 100943426) has the molecular formula C29H40N2O and a molecular weight of 432.65 g/mol. Its IUPAC name is (8R,9S,10S,13S,14S,17E)-17-[2-[4-(dimethylamino)phenyl]iminoethylidene]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-16-one.
| Compound Name | (8R,9S,10S,13S,14S,17E)-17-[2-[4-(dimethylamino)phenyl]iminoethylidene]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-16-one |
|---|---|
| PubChem CID | 100943426 |
| Molecular Formula | C29H40N2O |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | (8R,9S,10S,13S,14S,17E)-17-[2-[4-(dimethylamino)phenyl]iminoethylidene]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-16-one |
| SMILES | CN(C)c1ccc(/N=C/C=C2/C(=O)C[C@H]3[C@@H]4CCC5CCCC[C@]5(C)[C@H]4CC[C@]23C)cc1 |
| InChI | InChI=1S/C29H40N2O/c1-28-16-6-5-7-20(28)8-13-23-24(28)14-17-29(2)25(27(32)19-26(23)29)15-18-30-21-9-11-22(12-10-21)31(3)4/h9-12,15,18,20,23-24,26H,5-8,13-14,16-17,19H2,1-4H3/b25-15-,30-18+/t20?,23-,24+,26+,28+,29-/m1/s1 |
| InChIKey | AFCXNFQIYVHTDD-WKFFNCTKSA-N |
| XLogP | 6.99 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|