C22H34O5 — CID 100943920
1-(5,6-dihydroxy-6-methylheptan-2-yl)-7-methoxy-3a-methyl-3,5,6,7,9,9a-hexahydrocyclopenta[b]chromen-8-one (PubChem CID 100943920) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is 1-(5,6-dihydroxy-6-methylheptan-2-yl)-7-methoxy-3a-methyl-3,5,6,7,9,9a-hexahydrocyclopenta[b]chromen-8-one.
| Compound Name | 1-(5,6-dihydroxy-6-methylheptan-2-yl)-7-methoxy-3a-methyl-3,5,6,7,9,9a-hexahydrocyclopenta[b]chromen-8-one |
|---|---|
| PubChem CID | 100943920 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 1-(5,6-dihydroxy-6-methylheptan-2-yl)-7-methoxy-3a-methyl-3,5,6,7,9,9a-hexahydrocyclopenta[b]chromen-8-one |
| SMILES | COC1CCC2=C(CC3C(C(C)CCC(O)C(C)(C)O)=CCC3(C)O2)C1=O |
| InChI | InChI=1S/C22H34O5/c1-13(6-9-19(23)21(2,3)25)14-10-11-22(4)16(14)12-15-17(27-22)7-8-18(26-5)20(15)24/h10,13,16,18-19,23,25H,6-9,11-12H2,1-5H3 |
| InChIKey | UWIMHIVGWQTLQY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|