C20H18N2O2 — CID 100944018
2,5-bis(2-methylanilino)cyclohexa-2,5-diene-1,4-dione (PubChem CID 100944018) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 2,5-bis(2-methylanilino)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-bis(2-methylanilino)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 100944018 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 2,5-bis(2-methylanilino)cyclohexa-2,5-diene-1,4-dione |
| SMILES | Cc1ccccc1NC1=CC(=O)C(Nc2ccccc2C)=CC1=O |
| InChI | InChI=1S/C20H18N2O2/c1-13-7-3-5-9-15(13)21-17-11-20(24)18(12-19(17)23)22-16-10-6-4-8-14(16)2/h3-12,21-22H,1-2H3 |
| InChIKey | QJOYQAODZKIBDH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|