About 5-diethoxyphosphoryl-1,2,3-tripropoxybenzene
5-diethoxyphosphoryl-1,2,3-tripropoxybenzene (PubChem CID 100944077) has the molecular formula C19H33O6P
and a molecular weight of 388.44 g/mol. Its IUPAC name is 5-diethoxyphosphoryl-1,2,3-tripropoxybenzene.
Molecular Properties
| Compound Name | 5-diethoxyphosphoryl-1,2,3-tripropoxybenzene |
| PubChem CID | 100944077 |
| Molecular Formula | C19H33O6P |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 5-diethoxyphosphoryl-1,2,3-tripropoxybenzene |
| SMILES | CCCOc1cc(P(=O)(OCC)OCC)cc(OCCC)c1OCCC |
| InChI | InChI=1S/C19H33O6P/c1-6-11-21-17-14-16(26(20,24-9-4)25-10-5)15-18(22-12-7-2)19(17)23-13-8-3/h14-15H,6-13H2,1-5H3 |
| InChIKey | WUYCAKRKRNPIGC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5-diethoxyphosphoryl-1,2,3-tripropoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-diethoxyphosphoryl-1,2,3-tripropoxybenzene?
The IUPAC name of 5-diethoxyphosphoryl-1,2,3-tripropoxybenzene (CID 100944077) is 5-diethoxyphosphoryl-1,2,3-tripropoxybenzene.
What is the SMILES notation for 5-diethoxyphosphoryl-1,2,3-tripropoxybenzene?
The canonical SMILES for 5-diethoxyphosphoryl-1,2,3-tripropoxybenzene is CCCOc1cc(P(=O)(OCC)OCC)cc(OCCC)c1OCCC.
What is the InChIKey of 5-diethoxyphosphoryl-1,2,3-tripropoxybenzene?
The InChIKey is WUYCAKRKRNPIGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H33O6P/c1-6-11-21-17-14-16(26(20,24-9-4)25-10-5)15-18(22-12-7-2)19(17)23-13-8-3/h14-15H,6-13H2,1-5H3.
What are the key properties of 5-diethoxyphosphoryl-1,2,3-tripropoxybenzene?
5-diethoxyphosphoryl-1,2,3-tripropoxybenzene has a molecular weight of 388.44 g/mol, XLogP of 4.94, 14 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-diethoxyphosphoryl-1,2,3-tripropoxybenzene is sourced from PubChem (CID 100944077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).