C15H22N4O11 — CID 10094442
(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-carboxypropanoyl]amino]propanoyl]amino]-3-carboxypropanoyl]amino]butanedioic acid (PubChem CID 10094442) has the molecular formula C15H22N4O11 and a molecular weight of 434.36 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-carboxypropanoyl]amino]propanoyl]amino]-3-carboxypropanoyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-carboxypropanoyl]amino]propanoyl]amino]-3-carboxypropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 10094442 |
| Molecular Formula | C15H22N4O11 |
| Molecular Weight | 434.36 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-carboxypropanoyl]amino]propanoyl]amino]-3-carboxypropanoyl]amino]butanedioic acid |
| SMILES | C[C@H](NC(=O)[C@@H](N)CC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H22N4O11/c1-5(17-13(27)6(16)2-9(20)21)12(26)18-7(3-10(22)23)14(28)19-8(15(29)30)4-11(24)25/h5-8H,2-4,16H2,1H3,(H,17,27)(H,18,26)(H,19,28)(H,20,21)(H,22,23)(H,24,25)(H,29,30)/t5-,6-,7-,8-/m0/s1 |
| InChIKey | QLMZPABFHXYEKN-XAMCCFCMSA-N |
| XLogP | -3.70 |
| TPSA | 262.52 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.36 |
| LogP ≤ 5 | -3.70 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |