C27H25N5O — CID 10094509
N'-[(1R)-2-(1H-indol-3-yl)-1-(5-phenyl-1H-imidazol-2-yl)ethyl]-4-methoxybenzenecarboximidamide (PubChem CID 10094509) has the molecular formula C27H25N5O and a molecular weight of 435.53 g/mol. Its IUPAC name is N'-[(1R)-2-(1H-indol-3-yl)-1-(5-phenyl-1H-imidazol-2-yl)ethyl]-4-methoxybenzenecarboximidamide.
| Compound Name | N'-[(1R)-2-(1H-indol-3-yl)-1-(5-phenyl-1H-imidazol-2-yl)ethyl]-4-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 10094509 |
| Molecular Formula | C27H25N5O |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | N'-[(1R)-2-(1H-indol-3-yl)-1-(5-phenyl-1H-imidazol-2-yl)ethyl]-4-methoxybenzenecarboximidamide |
| SMILES | COc1ccc(/C(N)=N/[C@H](Cc2c[nH]c3ccccc23)c2ncc(-c3ccccc3)[nH]2)cc1 |
| InChI | InChI=1S/C27H25N5O/c1-33-21-13-11-19(12-14-21)26(28)31-24(15-20-16-29-23-10-6-5-9-22(20)23)27-30-17-25(32-27)18-7-3-2-4-8-18/h2-14,16-17,24,29H,15H2,1H3,(H2,28,31)(H,30,32)/t24-/m1/s1 |
| InChIKey | FPROEWGCWWRFDP-XMMPIXPASA-N |
| XLogP | 5.26 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|