C72H71N3O3S6 — CID 100945119
1-(4-hexoxyphenyl)-2,5-bis[5-[5-[1-(4-hexoxyphenyl)-5-thiophen-2-ylpyrrol-2-yl]thiophen-2-yl]thiophen-2-yl]pyrrole (PubChem CID 100945119) has the molecular formula C72H71N3O3S6 and a molecular weight of 1218.78 g/mol. Its IUPAC name is 1-(4-hexoxyphenyl)-2,5-bis[5-[5-[1-(4-hexoxyphenyl)-5-thiophen-2-ylpyrrol-2-yl]thiophen-2-yl]thiophen-2-yl]pyrrole.
| Compound Name | 1-(4-hexoxyphenyl)-2,5-bis[5-[5-[1-(4-hexoxyphenyl)-5-thiophen-2-ylpyrrol-2-yl]thiophen-2-yl]thiophen-2-yl]pyrrole |
|---|---|
| PubChem CID | 100945119 |
| Molecular Formula | C72H71N3O3S6 |
| Molecular Weight | 1218.78 g/mol |
| Exact Mass | 1217.38 |
| IUPAC Name | 1-(4-hexoxyphenyl)-2,5-bis[5-[5-[1-(4-hexoxyphenyl)-5-thiophen-2-ylpyrrol-2-yl]thiophen-2-yl]thiophen-2-yl]pyrrole |
| SMILES | CCCCCCOc1ccc(-n2c(-c3cccs3)ccc2-c2ccc(-c3ccc(-c4ccc(-c5ccc(-c6ccc(-c7ccc(-c8cccs8)n7-c7ccc(OCCCCCC)cc7)s6)s5)n4-c4ccc(OCCCCCC)cc4)s3)s2)cc1 |
| InChI | InChI=1S/C72H71N3O3S6/c1-4-7-10-13-46-76-54-26-20-51(21-27-54)73-57(63-18-16-49-79-63)32-34-59(73)65-38-42-69(81-65)71-44-40-67(83-71)61-36-37-62(75(61)53-24-30-56(31-25-53)78-48-15-12-9-6-3)68-41-45-72(84-68)70-43-39-66(82-70)60-35-33-58(64-19-17-50-80-64)74(60)52-22-28-55(29-23-52)77-47-14-11-8-5-2/h16-45,49-50H,4-15,46-48H2,1-3H3 |
| InChIKey | KVIJFKZUOCMICZ-UHFFFAOYSA-N |
| XLogP | 23.64 |
| TPSA | 42.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 84 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1218.78 |
| LogP ≤ 5 | 23.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|