C23H38N2O5 — CID 100946033
methyl (12R,14S,17S,18R,21S)-12-(hydroxymethyl)-17-methoxy-2-oxo-1,16-diazatetracyclo[10.8.1.014,18.017,21]henicosane-16-carboxylate (PubChem CID 100946033) has the molecular formula C23H38N2O5 and a molecular weight of 422.57 g/mol. Its IUPAC name is methyl (12R,14S,17S,18R,21S)-12-(hydroxymethyl)-17-methoxy-2-oxo-1,16-diazatetracyclo[10.8.1.014,18.017,21]henicosane-16-carboxylate.
| Compound Name | methyl (12R,14S,17S,18R,21S)-12-(hydroxymethyl)-17-methoxy-2-oxo-1,16-diazatetracyclo[10.8.1.014,18.017,21]henicosane-16-carboxylate |
|---|---|
| PubChem CID | 100946033 |
| Molecular Formula | C23H38N2O5 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | methyl (12R,14S,17S,18R,21S)-12-(hydroxymethyl)-17-methoxy-2-oxo-1,16-diazatetracyclo[10.8.1.014,18.017,21]henicosane-16-carboxylate |
| SMILES | COC(=O)N1C[C@H]2C[C@]3(CO)CCCCCCCCCC(=O)N4CC[C@H]2[C@]1(OC)[C@@H]43 |
| InChI | InChI=1S/C23H38N2O5/c1-29-21(28)25-15-17-14-22(16-26)12-9-7-5-3-4-6-8-10-19(27)24-13-11-18(17)23(25,30-2)20(22)24/h17-18,20,26H,3-16H2,1-2H3/t17-,18-,20+,22+,23+/m1/s1 |
| InChIKey | DXFQGNTYNVRUAQ-IYVPXIFYSA-N |
| XLogP | 3.15 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |