About CID 100946403
CID 100946403 (PubChem CID 100946403) has the molecular formula C30H39N4O3
and a molecular weight of 503.67 g/mol.
Molecular Properties
| Compound Name | CID 100946403 |
| PubChem CID | 100946403 |
| Molecular Formula | C30H39N4O3 |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.30 |
| IUPAC Name | — |
| SMILES | CC(C)(C)N([O])c1ccc(N(c2ccc(N([O-])C(C)(C)C)cc2)c2ccc([N+](=O)C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C30H39N4O3/c1-28(2,3)32(35)25-16-10-22(11-17-25)31(23-12-18-26(19-13-23)33(36)29(4,5)6)24-14-20-27(21-15-24)34(37)30(7,8)9/h10-21H,1-9H3 |
| InChIKey | PHOIIONYRAUSGY-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 72.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 100946403 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 100946403?
The IUPAC name of CID 100946403 (CID 100946403) is not available.
What is the SMILES notation for CID 100946403?
The canonical SMILES for CID 100946403 is CC(C)(C)N([O])c1ccc(N(c2ccc(N([O-])C(C)(C)C)cc2)c2ccc([N+](=O)C(C)(C)C)cc2)cc1.
What is the InChIKey of CID 100946403?
The InChIKey is PHOIIONYRAUSGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H39N4O3/c1-28(2,3)32(35)25-16-10-22(11-17-25)31(23-12-18-26(19-13-23)33(36)29(4,5)6)24-14-20-27(21-15-24)34(37)30(7,8)9/h10-21H,1-9H3.
What are the key properties of CID 100946403?
CID 100946403 has a molecular weight of 503.67 g/mol, XLogP of 8.42, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 100946403 is sourced from PubChem (CID 100946403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).