C50H59N7O3 — CID 100946770
2-[4,7-bis[2-[[(1S)-1-naphthalen-2-ylethyl]amino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]-N-[(1S)-1-naphthalen-2-ylethyl]acetamide (PubChem CID 100946770) has the molecular formula C50H59N7O3 and a molecular weight of 806.07 g/mol. Its IUPAC name is 2-[4,7-bis[2-[[(1S)-1-naphthalen-2-ylethyl]amino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]-N-[(1S)-1-naphthalen-2-ylethyl]acetamide.
| Compound Name | 2-[4,7-bis[2-[[(1S)-1-naphthalen-2-ylethyl]amino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]-N-[(1S)-1-naphthalen-2-ylethyl]acetamide |
|---|---|
| PubChem CID | 100946770 |
| Molecular Formula | C50H59N7O3 |
| Molecular Weight | 806.07 g/mol |
| Exact Mass | 805.47 |
| IUPAC Name | 2-[4,7-bis[2-[[(1S)-1-naphthalen-2-ylethyl]amino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]-N-[(1S)-1-naphthalen-2-ylethyl]acetamide |
| SMILES | C[C@H](NC(=O)CN1CCNCCN(CC(=O)N[C@@H](C)c2ccc3ccccc3c2)CCN(CC(=O)N[C@@H](C)c2ccc3ccccc3c2)CC1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C50H59N7O3/c1-36(42-19-16-39-10-4-7-13-45(39)30-42)52-48(58)33-55-24-22-51-23-25-56(34-49(59)53-37(2)43-20-17-40-11-5-8-14-46(40)31-43)27-29-57(28-26-55)35-50(60)54-38(3)44-21-18-41-12-6-9-15-47(41)32-44/h4-21,30-32,36-38,51H,22-29,33-35H2,1-3H3,(H,52,58)(H,53,59)(H,54,60)/t36-,37-,38-/m0/s1 |
| InChIKey | VQJXAWWHTCAVRZ-QXUSSCGESA-N |
| XLogP | 6.59 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.07 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |