C30H33NO2 — CID 10094741
4-(1-cyclopropyl-7,7,10,10-tetramethyl-4,5,8,9-tetrahydronaphtho[2,3-g]indol-3-yl)benzoic acid (PubChem CID 10094741) has the molecular formula C30H33NO2 and a molecular weight of 439.60 g/mol. Its IUPAC name is 4-(1-cyclopropyl-7,7,10,10-tetramethyl-4,5,8,9-tetrahydronaphtho[2,3-g]indol-3-yl)benzoic acid.
| Compound Name | 4-(1-cyclopropyl-7,7,10,10-tetramethyl-4,5,8,9-tetrahydronaphtho[2,3-g]indol-3-yl)benzoic acid |
|---|---|
| PubChem CID | 10094741 |
| Molecular Formula | C30H33NO2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 4-(1-cyclopropyl-7,7,10,10-tetramethyl-4,5,8,9-tetrahydronaphtho[2,3-g]indol-3-yl)benzoic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc3c(cc21)CCc1c(-c2ccc(C(=O)O)cc2)cn(C2CC2)c1-3 |
| InChI | InChI=1S/C30H33NO2/c1-29(2)13-14-30(3,4)26-16-23-20(15-25(26)29)9-12-22-24(17-31(27(22)23)21-10-11-21)18-5-7-19(8-6-18)28(32)33/h5-8,15-17,21H,9-14H2,1-4H3,(H,32,33) |
| InChIKey | LSLCBGGPWJFMOU-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |