C8F13O- — CID 100947572
3,3,4,5,5,6,6-heptafluoro-2,4-bis(trifluoromethyl)cyclohexen-1-olate (PubChem CID 100947572) has the molecular formula C8F13O- and a molecular weight of 359.06 g/mol. Its IUPAC name is 3,3,4,5,5,6,6-heptafluoro-2,4-bis(trifluoromethyl)cyclohexen-1-olate.
| Compound Name | 3,3,4,5,5,6,6-heptafluoro-2,4-bis(trifluoromethyl)cyclohexen-1-olate |
|---|---|
| PubChem CID | 100947572 |
| Molecular Formula | C8F13O- |
| Molecular Weight | 359.06 g/mol |
| Exact Mass | 358.97 |
| IUPAC Name | 3,3,4,5,5,6,6-heptafluoro-2,4-bis(trifluoromethyl)cyclohexen-1-olate |
| SMILES | [O-]C1=C(C(F)(F)F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8HF13O/c9-3(10)1(5(13,14)15)2(22)4(11,12)7(17,18)6(3,16)8(19,20)21/h22H/p-1 |
| InChIKey | FGSRPKWBLABEAA-UHFFFAOYSA-M |
| XLogP | 3.35 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.06 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|