About 2-[(E)-hept-2-en-6-ynyl]-N,N-dimethylaniline
2-[(E)-hept-2-en-6-ynyl]-N,N-dimethylaniline (PubChem CID 100947901) has the molecular formula C15H19N
and a molecular weight of 213.32 g/mol. Its IUPAC name is 2-[(E)-hept-2-en-6-ynyl]-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 2-[(E)-hept-2-en-6-ynyl]-N,N-dimethylaniline |
| PubChem CID | 100947901 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2-[(E)-hept-2-en-6-ynyl]-N,N-dimethylaniline |
| SMILES | C#CCC/C=C/Cc1ccccc1N(C)C |
| InChI | InChI=1S/C15H19N/c1-4-5-6-7-8-11-14-12-9-10-13-15(14)16(2)3/h1,7-10,12-13H,5-6,11H2,2-3H3/b8-7+ |
| InChIKey | LETQJPMABHFBGP-BQYQJAHWSA-N |
| XLogP | 3.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-hept-2-en-6-ynyl]-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-hept-2-en-6-ynyl]-N,N-dimethylaniline?
The IUPAC name of 2-[(E)-hept-2-en-6-ynyl]-N,N-dimethylaniline (CID 100947901) is 2-[(E)-hept-2-en-6-ynyl]-N,N-dimethylaniline.
What is the SMILES notation for 2-[(E)-hept-2-en-6-ynyl]-N,N-dimethylaniline?
The canonical SMILES for 2-[(E)-hept-2-en-6-ynyl]-N,N-dimethylaniline is C#CCC/C=C/Cc1ccccc1N(C)C.
What is the InChIKey of 2-[(E)-hept-2-en-6-ynyl]-N,N-dimethylaniline?
The InChIKey is LETQJPMABHFBGP-BQYQJAHWSA-N. The full InChI is InChI=1S/C15H19N/c1-4-5-6-7-8-11-14-12-9-10-13-15(14)16(2)3/h1,7-10,12-13H,5-6,11H2,2-3H3/b8-7+.
What are the key properties of 2-[(E)-hept-2-en-6-ynyl]-N,N-dimethylaniline?
2-[(E)-hept-2-en-6-ynyl]-N,N-dimethylaniline has a molecular weight of 213.32 g/mol, XLogP of 3.26, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-hept-2-en-6-ynyl]-N,N-dimethylaniline is sourced from PubChem (CID 100947901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).