About 3,6-diamino-2,7-bis[2-(diethylamino)ethoxy]fluoren-9-one
3,6-diamino-2,7-bis[2-(diethylamino)ethoxy]fluoren-9-one (PubChem CID 10094803) has the molecular formula C25H36N4O3
and a molecular weight of 440.59 g/mol. Its IUPAC name is 3,6-diamino-2,7-bis[2-(diethylamino)ethoxy]fluoren-9-one.
Molecular Properties
| Compound Name | 3,6-diamino-2,7-bis[2-(diethylamino)ethoxy]fluoren-9-one |
| PubChem CID | 10094803 |
| Molecular Formula | C25H36N4O3 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | 3,6-diamino-2,7-bis[2-(diethylamino)ethoxy]fluoren-9-one |
| SMILES | CCN(CC)CCOc1cc2c(cc1N)-c1cc(N)c(OCCN(CC)CC)cc1C2=O |
| InChI | InChI=1S/C25H36N4O3/c1-5-28(6-2)9-11-31-23-15-19-17(13-21(23)26)18-14-22(27)24(16-20(18)25(19)30)32-12-10-29(7-3)8-4/h13-16H,5-12,26-27H2,1-4H3 |
| InChIKey | VFNJHRGCSSGTCD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,6-diamino-2,7-bis[2-(diethylamino)ethoxy]fluoren-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-diamino-2,7-bis[2-(diethylamino)ethoxy]fluoren-9-one?
The IUPAC name of 3,6-diamino-2,7-bis[2-(diethylamino)ethoxy]fluoren-9-one (CID 10094803) is 3,6-diamino-2,7-bis[2-(diethylamino)ethoxy]fluoren-9-one.
What is the SMILES notation for 3,6-diamino-2,7-bis[2-(diethylamino)ethoxy]fluoren-9-one?
The canonical SMILES for 3,6-diamino-2,7-bis[2-(diethylamino)ethoxy]fluoren-9-one is CCN(CC)CCOc1cc2c(cc1N)-c1cc(N)c(OCCN(CC)CC)cc1C2=O.
What is the InChIKey of 3,6-diamino-2,7-bis[2-(diethylamino)ethoxy]fluoren-9-one?
The InChIKey is VFNJHRGCSSGTCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H36N4O3/c1-5-28(6-2)9-11-31-23-15-19-17(13-21(23)26)18-14-22(27)24(16-20(18)25(19)30)32-12-10-29(7-3)8-4/h13-16H,5-12,26-27H2,1-4H3.
What are the key properties of 3,6-diamino-2,7-bis[2-(diethylamino)ethoxy]fluoren-9-one?
3,6-diamino-2,7-bis[2-(diethylamino)ethoxy]fluoren-9-one has a molecular weight of 440.59 g/mol, XLogP of 3.50, 12 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-diamino-2,7-bis[2-(diethylamino)ethoxy]fluoren-9-one is sourced from PubChem (CID 10094803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).